C14H12N2O2 — CID 137190173
8-methyl-2-(3-methylfuran-2-yl)-3H-quinazolin-4-one (PubChem CID 137190173) has the molecular formula C14H12N2O2 and a molecular weight of 240.26 g/mol. Its IUPAC name is 8-methyl-2-(3-methylfuran-2-yl)-3H-quinazolin-4-one.
| Compound Name | 8-methyl-2-(3-methylfuran-2-yl)-3H-quinazolin-4-one |
|---|---|
| PubChem CID | 137190173 |
| Molecular Formula | C14H12N2O2 |
| Molecular Weight | 240.26 g/mol |
| Exact Mass | 240.09 |
| IUPAC Name | 8-methyl-2-(3-methylfuran-2-yl)-3H-quinazolin-4-one |
| SMILES | Cc1ccoc1-c1nc2c(C)cccc2c(=O)[nH]1 |
| InChI | InChI=1S/C14H12N2O2/c1-8-4-3-5-10-11(8)15-13(16-14(10)17)12-9(2)6-7-18-12/h3-7H,1-2H3,(H,15,16,17) |
| InChIKey | YIJSFZMAUKZRMN-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.26 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |