C18H25N3O2S — CID 142611388
2-[[1-(3-hydroxypropyl)piperidin-4-yl]sulfanylmethyl]-8-methyl-3H-quinazolin-4-one (PubChem CID 142611388) has the molecular formula C18H25N3O2S and a molecular weight of 347.48 g/mol. Its IUPAC name is 2-[[1-(3-hydroxypropyl)piperidin-4-yl]sulfanylmethyl]-8-methyl-3H-quinazolin-4-one.
| Compound Name | 2-[[1-(3-hydroxypropyl)piperidin-4-yl]sulfanylmethyl]-8-methyl-3H-quinazolin-4-one |
|---|---|
| PubChem CID | 142611388 |
| Molecular Formula | C18H25N3O2S |
| Molecular Weight | 347.48 g/mol |
| Exact Mass | 347.17 |
| IUPAC Name | 2-[[1-(3-hydroxypropyl)piperidin-4-yl]sulfanylmethyl]-8-methyl-3H-quinazolin-4-one |
| SMILES | Cc1cccc2c(=O)[nH]c(CSC3CCN(CCCO)CC3)nc12 |
| InChI | InChI=1S/C18H25N3O2S/c1-13-4-2-5-15-17(13)19-16(20-18(15)23)12-24-14-6-9-21(10-7-14)8-3-11-22/h2,4-5,14,22H,3,6-12H2,1H3,(H,19,20,23) |
| InChIKey | AWIUZHRTRRYRQY-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 69.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.48 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |