C19H25N5OS — CID 174035669
2-[[1-(2-amino-4-iminobut-2-enyl)piperidin-4-yl]sulfanylmethyl]-8-methyl-3H-quinazolin-4-one (PubChem CID 174035669) has the molecular formula C19H25N5OS and a molecular weight of 371.51 g/mol. Its IUPAC name is 2-[[1-(2-amino-4-iminobut-2-enyl)piperidin-4-yl]sulfanylmethyl]-8-methyl-3H-quinazolin-4-one.
| Compound Name | 2-[[1-(2-amino-4-iminobut-2-enyl)piperidin-4-yl]sulfanylmethyl]-8-methyl-3H-quinazolin-4-one |
|---|---|
| PubChem CID | 174035669 |
| Molecular Formula | C19H25N5OS |
| Molecular Weight | 371.51 g/mol |
| Exact Mass | 371.18 |
| IUPAC Name | 2-[[1-(2-amino-4-iminobut-2-enyl)piperidin-4-yl]sulfanylmethyl]-8-methyl-3H-quinazolin-4-one |
| SMILES | [H]/N=C/C=C(N)CN1CCC(SCc2nc3c(C)cccc3c(=O)[nH]2)CC1 |
| InChI | InChI=1S/C19H25N5OS/c1-13-3-2-4-16-18(13)22-17(23-19(16)25)12-26-15-6-9-24(10-7-15)11-14(21)5-8-20/h2-5,8,15,20H,6-7,9-12,21H2,1H3,(H,22,23,25)/b14-5?,20-8+ |
| InChIKey | QSCVMLMXEVFOEK-LOZSMVDLSA-N |
| XLogP | 2.42 |
| TPSA | 98.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.51 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|