C21H24Cl2N4O — CID 140545004
N'-[2-(1-benzofuran-2-yl)quinazolin-4-yl]-N-ethylpropane-1,3-diamine;dihydrochloride (PubChem CID 140545004) has the molecular formula C21H24Cl2N4O and a molecular weight of 419.36 g/mol. Its IUPAC name is N'-[2-(1-benzofuran-2-yl)quinazolin-4-yl]-N-ethylpropane-1,3-diamine;dihydrochloride.
| Compound Name | N'-[2-(1-benzofuran-2-yl)quinazolin-4-yl]-N-ethylpropane-1,3-diamine;dihydrochloride |
|---|---|
| PubChem CID | 140545004 |
| Molecular Formula | C21H24Cl2N4O |
| Molecular Weight | 419.36 g/mol |
| Exact Mass | 418.13 |
| IUPAC Name | N'-[2-(1-benzofuran-2-yl)quinazolin-4-yl]-N-ethylpropane-1,3-diamine;dihydrochloride |
| SMILES | CCNCCCNc1nc(-c2cc3ccccc3o2)nc2ccccc12.Cl.Cl |
| InChI | InChI=1S/C21H22N4O.2ClH/c1-2-22-12-7-13-23-20-16-9-4-5-10-17(16)24-21(25-20)19-14-15-8-3-6-11-18(15)26-19;;/h3-6,8-11,14,22H,2,7,12-13H2,1H3,(H,23,24,25);2*1H |
| InChIKey | GISAZTUZYFFWDA-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 62.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.36 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|