C21H23Cl2FN4O — CID 69069935
N-[2-(1-benzofuran-2-yl)-7-fluoroquinazolin-4-yl]-N',N'-dimethylpropane-1,3-diamine;dihydrochloride (PubChem CID 69069935) has the molecular formula C21H23Cl2FN4O and a molecular weight of 437.35 g/mol. Its IUPAC name is N-[2-(1-benzofuran-2-yl)-7-fluoroquinazolin-4-yl]-N',N'-dimethylpropane-1,3-diamine;dihydrochloride.
| Compound Name | N-[2-(1-benzofuran-2-yl)-7-fluoroquinazolin-4-yl]-N',N'-dimethylpropane-1,3-diamine;dihydrochloride |
|---|---|
| PubChem CID | 69069935 |
| Molecular Formula | C21H23Cl2FN4O |
| Molecular Weight | 437.35 g/mol |
| Exact Mass | 436.12 |
| IUPAC Name | N-[2-(1-benzofuran-2-yl)-7-fluoroquinazolin-4-yl]-N',N'-dimethylpropane-1,3-diamine;dihydrochloride |
| SMILES | CN(C)CCCNc1nc(-c2cc3ccccc3o2)nc2cc(F)ccc12.Cl.Cl |
| InChI | InChI=1S/C21H21FN4O.2ClH/c1-26(2)11-5-10-23-20-16-9-8-15(22)13-17(16)24-21(25-20)19-12-14-6-3-4-7-18(14)27-19;;/h3-4,6-9,12-13H,5,10-11H2,1-2H3,(H,23,24,25);2*1H |
| InChIKey | ILUOAKMILAXZEM-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 54.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.35 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|