C16H12N4S2 — CID 49430846
N-(1,3-thiazol-4-ylmethyl)-2-thiophen-3-ylquinazolin-4-amine (PubChem CID 49430846) has the molecular formula C16H12N4S2 and a molecular weight of 324.43 g/mol. Its IUPAC name is N-(1,3-thiazol-4-ylmethyl)-2-thiophen-3-ylquinazolin-4-amine.
| Compound Name | N-(1,3-thiazol-4-ylmethyl)-2-thiophen-3-ylquinazolin-4-amine |
|---|---|
| PubChem CID | 49430846 |
| Molecular Formula | C16H12N4S2 |
| Molecular Weight | 324.43 g/mol |
| Exact Mass | 324.05 |
| IUPAC Name | N-(1,3-thiazol-4-ylmethyl)-2-thiophen-3-ylquinazolin-4-amine |
| SMILES | c1ccc2c(NCc3cscn3)nc(-c3ccsc3)nc2c1 |
| InChI | InChI=1S/C16H12N4S2/c1-2-4-14-13(3-1)16(17-7-12-9-22-10-18-12)20-15(19-14)11-5-6-21-8-11/h1-6,8-10H,7H2,(H,17,19,20) |
| InChIKey | VGRNWWPZUOZECO-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.43 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |