C18H19N3OS — CID 42950794
N-[1-(oxolan-2-yl)ethyl]-2-thiophen-3-ylquinazolin-4-amine (PubChem CID 42950794) has the molecular formula C18H19N3OS and a molecular weight of 325.44 g/mol. Its IUPAC name is N-[1-(oxolan-2-yl)ethyl]-2-thiophen-3-ylquinazolin-4-amine.
| Compound Name | N-[1-(oxolan-2-yl)ethyl]-2-thiophen-3-ylquinazolin-4-amine |
|---|---|
| PubChem CID | 42950794 |
| Molecular Formula | C18H19N3OS |
| Molecular Weight | 325.44 g/mol |
| Exact Mass | 325.12 |
| IUPAC Name | N-[1-(oxolan-2-yl)ethyl]-2-thiophen-3-ylquinazolin-4-amine |
| SMILES | CC(Nc1nc(-c2ccsc2)nc2ccccc12)C1CCCO1 |
| InChI | InChI=1S/C18H19N3OS/c1-12(16-7-4-9-22-16)19-18-14-5-2-3-6-15(14)20-17(21-18)13-8-10-23-11-13/h2-3,5-6,8,10-12,16H,4,7,9H2,1H3,(H,19,20,21) |
| InChIKey | YQLNPRVKGHYXJQ-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.44 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |