C20H23N3OS2 — CID 133338088
N-(3-ethylsulfinylcyclohexyl)-2-thiophen-3-ylquinazolin-4-amine (PubChem CID 133338088) has the molecular formula C20H23N3OS2 and a molecular weight of 385.56 g/mol. Its IUPAC name is N-(3-ethylsulfinylcyclohexyl)-2-thiophen-3-ylquinazolin-4-amine.
| Compound Name | N-(3-ethylsulfinylcyclohexyl)-2-thiophen-3-ylquinazolin-4-amine |
|---|---|
| PubChem CID | 133338088 |
| Molecular Formula | C20H23N3OS2 |
| Molecular Weight | 385.56 g/mol |
| Exact Mass | 385.13 |
| IUPAC Name | N-(3-ethylsulfinylcyclohexyl)-2-thiophen-3-ylquinazolin-4-amine |
| SMILES | CCS(=O)C1CCCC(Nc2nc(-c3ccsc3)nc3ccccc23)C1 |
| InChI | InChI=1S/C20H23N3OS2/c1-2-26(24)16-7-5-6-15(12-16)21-20-17-8-3-4-9-18(17)22-19(23-20)14-10-11-25-13-14/h3-4,8-11,13,15-16H,2,5-7,12H2,1H3,(H,21,22,23) |
| InChIKey | DRWLFLCHOMKVDI-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.56 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |