C18H20N4S2 — CID 133304965
N-(3-methylsulfanylpropyl)-10-pyridin-3-yl-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-amine (PubChem CID 133304965) has the molecular formula C18H20N4S2 and a molecular weight of 356.52 g/mol. Its IUPAC name is N-(3-methylsulfanylpropyl)-10-pyridin-3-yl-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-amine.
| Compound Name | N-(3-methylsulfanylpropyl)-10-pyridin-3-yl-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-amine |
|---|---|
| PubChem CID | 133304965 |
| Molecular Formula | C18H20N4S2 |
| Molecular Weight | 356.52 g/mol |
| Exact Mass | 356.11 |
| IUPAC Name | N-(3-methylsulfanylpropyl)-10-pyridin-3-yl-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-amine |
| SMILES | CSCCCNc1nc(-c2cccnc2)nc2sc3c(c12)CCC3 |
| InChI | InChI=1S/C18H20N4S2/c1-23-10-4-9-20-17-15-13-6-2-7-14(13)24-18(15)22-16(21-17)12-5-3-8-19-11-12/h3,5,8,11H,2,4,6-7,9-10H2,1H3,(H,20,21,22) |
| InChIKey | FYEXSUBQDDCKIL-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.52 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|