C21H19N5S — CID 30226027
10-pyridin-3-yl-N-(2-pyridin-2-ylethyl)-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-amine (PubChem CID 30226027) has the molecular formula C21H19N5S and a molecular weight of 373.49 g/mol. Its IUPAC name is 10-pyridin-3-yl-N-(2-pyridin-2-ylethyl)-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-amine.
| Compound Name | 10-pyridin-3-yl-N-(2-pyridin-2-ylethyl)-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-amine |
|---|---|
| PubChem CID | 30226027 |
| Molecular Formula | C21H19N5S |
| Molecular Weight | 373.49 g/mol |
| Exact Mass | 373.14 |
| IUPAC Name | 10-pyridin-3-yl-N-(2-pyridin-2-ylethyl)-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-amine |
| SMILES | c1ccc(CCNc2nc(-c3cccnc3)nc3sc4c(c23)CCC4)nc1 |
| InChI | InChI=1S/C21H19N5S/c1-2-11-23-15(6-1)9-12-24-20-18-16-7-3-8-17(16)27-21(18)26-19(25-20)14-5-4-10-22-13-14/h1-2,4-6,10-11,13H,3,7-9,12H2,(H,24,25,26) |
| InChIKey | ZQDPKDFXHKYOQT-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 63.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.49 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |