C19H17N5S2 — CID 133290069
N-[(4-methyl-1,3-thiazol-5-yl)methyl]-10-pyridin-3-yl-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-amine (PubChem CID 133290069) has the molecular formula C19H17N5S2 and a molecular weight of 379.51 g/mol. Its IUPAC name is N-[(4-methyl-1,3-thiazol-5-yl)methyl]-10-pyridin-3-yl-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-amine.
| Compound Name | N-[(4-methyl-1,3-thiazol-5-yl)methyl]-10-pyridin-3-yl-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-amine |
|---|---|
| PubChem CID | 133290069 |
| Molecular Formula | C19H17N5S2 |
| Molecular Weight | 379.51 g/mol |
| Exact Mass | 379.09 |
| IUPAC Name | N-[(4-methyl-1,3-thiazol-5-yl)methyl]-10-pyridin-3-yl-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-amine |
| SMILES | Cc1ncsc1CNc1nc(-c2cccnc2)nc2sc3c(c12)CCC3 |
| InChI | InChI=1S/C19H17N5S2/c1-11-15(25-10-22-11)9-21-18-16-13-5-2-6-14(13)26-19(16)24-17(23-18)12-4-3-7-20-8-12/h3-4,7-8,10H,2,5-6,9H2,1H3,(H,21,23,24) |
| InChIKey | YLDULAITMCZXNG-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 63.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.51 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |