C21H23N5O2S — CID 133275699
methyl 3-[(10-pyridin-3-yl-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-yl)amino]piperidine-1-carboxylate (PubChem CID 133275699) has the molecular formula C21H23N5O2S and a molecular weight of 409.52 g/mol. Its IUPAC name is methyl 3-[(10-pyridin-3-yl-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-yl)amino]piperidine-1-carboxylate.
| Compound Name | methyl 3-[(10-pyridin-3-yl-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-yl)amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 133275699 |
| Molecular Formula | C21H23N5O2S |
| Molecular Weight | 409.52 g/mol |
| Exact Mass | 409.16 |
| IUPAC Name | methyl 3-[(10-pyridin-3-yl-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-yl)amino]piperidine-1-carboxylate |
| SMILES | COC(=O)N1CCCC(Nc2nc(-c3cccnc3)nc3sc4c(c23)CCC4)C1 |
| InChI | InChI=1S/C21H23N5O2S/c1-28-21(27)26-10-4-6-14(12-26)23-19-17-15-7-2-8-16(15)29-20(17)25-18(24-19)13-5-3-9-22-11-13/h3,5,9,11,14H,2,4,6-8,10,12H2,1H3,(H,23,24,25) |
| InChIKey | JYXBDENIDVOPJJ-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 80.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.52 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |