C20H22N6S2 — CID 133325381
2-thiophen-3-yl-N-[4-(1,2,4-triazol-4-yl)butyl]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-amine (PubChem CID 133325381) has the molecular formula C20H22N6S2 and a molecular weight of 410.57 g/mol. Its IUPAC name is 2-thiophen-3-yl-N-[4-(1,2,4-triazol-4-yl)butyl]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-amine.
| Compound Name | 2-thiophen-3-yl-N-[4-(1,2,4-triazol-4-yl)butyl]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 133325381 |
| Molecular Formula | C20H22N6S2 |
| Molecular Weight | 410.57 g/mol |
| Exact Mass | 410.13 |
| IUPAC Name | 2-thiophen-3-yl-N-[4-(1,2,4-triazol-4-yl)butyl]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-amine |
| SMILES | c1cc(-c2nc(NCCCCn3cnnc3)c3c4c(sc3n2)CCCC4)cs1 |
| InChI | InChI=1S/C20H22N6S2/c1-2-6-16-15(5-1)17-19(21-8-3-4-9-26-12-22-23-13-26)24-18(25-20(17)28-16)14-7-10-27-11-14/h7,10-13H,1-6,8-9H2,(H,21,24,25) |
| InChIKey | BPMYTRKECXDEGG-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 68.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.57 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|