C19H23N5S — CID 71576122
N',N'-dimethyl-N-(2-pyridin-4-yl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl)ethane-1,2-diamine (PubChem CID 71576122) has the molecular formula C19H23N5S and a molecular weight of 353.50 g/mol. Its IUPAC name is N',N'-dimethyl-N-(2-pyridin-4-yl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl)ethane-1,2-diamine.
| Compound Name | N',N'-dimethyl-N-(2-pyridin-4-yl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 71576122 |
| Molecular Formula | C19H23N5S |
| Molecular Weight | 353.50 g/mol |
| Exact Mass | 353.17 |
| IUPAC Name | N',N'-dimethyl-N-(2-pyridin-4-yl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl)ethane-1,2-diamine |
| SMILES | CN(C)CCNc1nc(-c2ccncc2)nc2sc3c(c12)CCCC3 |
| InChI | InChI=1S/C19H23N5S/c1-24(2)12-11-21-18-16-14-5-3-4-6-15(14)25-19(16)23-17(22-18)13-7-9-20-10-8-13/h7-10H,3-6,11-12H2,1-2H3,(H,21,22,23) |
| InChIKey | MVSBWAICGKGKKU-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 53.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.50 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |