C17H22N3O2S- — CID 7242258
6-[(2-methyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl)amino]hexanoate (PubChem CID 7242258) has the molecular formula C17H22N3O2S- and a molecular weight of 332.45 g/mol. Its IUPAC name is 6-[(2-methyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl)amino]hexanoate.
| Compound Name | 6-[(2-methyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl)amino]hexanoate |
|---|---|
| PubChem CID | 7242258 |
| Molecular Formula | C17H22N3O2S- |
| Molecular Weight | 332.45 g/mol |
| Exact Mass | 332.14 |
| IUPAC Name | 6-[(2-methyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl)amino]hexanoate |
| SMILES | Cc1nc(NCCCCCC(=O)[O-])c2c3c(sc2n1)CCCC3 |
| InChI | InChI=1S/C17H23N3O2S/c1-11-19-16(18-10-6-2-3-9-14(21)22)15-12-7-4-5-8-13(12)23-17(15)20-11/h2-10H2,1H3,(H,21,22)(H,18,19,20)/p-1 |
| InChIKey | FCIXJCSGBAIWRT-UHFFFAOYSA-M |
| XLogP | 2.60 |
| TPSA | 77.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.45 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|