C14H18N4OS — CID 9339663
N,N-dimethyl-2-[(10-methyl-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-yl)amino]acetamide (PubChem CID 9339663) has the molecular formula C14H18N4OS and a molecular weight of 290.39 g/mol. Its IUPAC name is N,N-dimethyl-2-[(10-methyl-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-yl)amino]acetamide.
| Compound Name | N,N-dimethyl-2-[(10-methyl-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-yl)amino]acetamide |
|---|---|
| PubChem CID | 9339663 |
| Molecular Formula | C14H18N4OS |
| Molecular Weight | 290.39 g/mol |
| Exact Mass | 290.12 |
| IUPAC Name | N,N-dimethyl-2-[(10-methyl-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-yl)amino]acetamide |
| SMILES | Cc1nc(NCC(=O)N(C)C)c2c3c(sc2n1)CCC3 |
| InChI | InChI=1S/C14H18N4OS/c1-8-16-13(15-7-11(19)18(2)3)12-9-5-4-6-10(9)20-14(12)17-8/h4-7H2,1-3H3,(H,15,16,17) |
| InChIKey | PVBUATSOOAGZOZ-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.39 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |