C20H22N4OS — CID 3206605
N-[2-[(2-methyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl)amino]ethyl]benzamide (PubChem CID 3206605) has the molecular formula C20H22N4OS and a molecular weight of 366.49 g/mol. Its IUPAC name is N-[2-[(2-methyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl)amino]ethyl]benzamide.
| Compound Name | N-[2-[(2-methyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl)amino]ethyl]benzamide |
|---|---|
| PubChem CID | 3206605 |
| Molecular Formula | C20H22N4OS |
| Molecular Weight | 366.49 g/mol |
| Exact Mass | 366.15 |
| IUPAC Name | N-[2-[(2-methyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl)amino]ethyl]benzamide |
| SMILES | Cc1nc(NCCNC(=O)c2ccccc2)c2c3c(sc2n1)CCCC3 |
| InChI | InChI=1S/C20H22N4OS/c1-13-23-18(17-15-9-5-6-10-16(15)26-20(17)24-13)21-11-12-22-19(25)14-7-3-2-4-8-14/h2-4,7-8H,5-6,9-12H2,1H3,(H,22,25)(H,21,23,24) |
| InChIKey | KXAUEYHSQKRJFR-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.49 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|