C24H20F2N6S — CID 41037782
N-[(1R)-1-[1-(difluoromethyl)benzimidazol-2-yl]ethyl]-10-pyridin-3-yl-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-amine (PubChem CID 41037782) has the molecular formula C24H20F2N6S and a molecular weight of 462.53 g/mol. Its IUPAC name is N-[(1R)-1-[1-(difluoromethyl)benzimidazol-2-yl]ethyl]-10-pyridin-3-yl-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-amine.
| Compound Name | N-[(1R)-1-[1-(difluoromethyl)benzimidazol-2-yl]ethyl]-10-pyridin-3-yl-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-amine |
|---|---|
| PubChem CID | 41037782 |
| Molecular Formula | C24H20F2N6S |
| Molecular Weight | 462.53 g/mol |
| Exact Mass | 462.14 |
| IUPAC Name | N-[(1R)-1-[1-(difluoromethyl)benzimidazol-2-yl]ethyl]-10-pyridin-3-yl-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-amine |
| SMILES | C[C@@H](Nc1nc(-c2cccnc2)nc2sc3c(c12)CCC3)c1nc2ccccc2n1C(F)F |
| InChI | InChI=1S/C24H20F2N6S/c1-13(22-29-16-8-2-3-9-17(16)32(22)24(25)26)28-21-19-15-7-4-10-18(15)33-23(19)31-20(30-21)14-6-5-11-27-12-14/h2-3,5-6,8-9,11-13,24H,4,7,10H2,1H3,(H,28,30,31)/t13-/m1/s1 |
| InChIKey | YPOWFSCZXNZFIN-CYBMUJFWSA-N |
| XLogP | 6.16 |
| TPSA | 68.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.53 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |