C21H18N8S2 — CID 133293701
2-pyrazin-2-yl-N-[(3-thiophen-2-yl-1H-1,2,4-triazol-5-yl)methyl]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-amine (PubChem CID 133293701) has the molecular formula C21H18N8S2 and a molecular weight of 446.57 g/mol. Its IUPAC name is 2-pyrazin-2-yl-N-[(3-thiophen-2-yl-1H-1,2,4-triazol-5-yl)methyl]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-amine.
| Compound Name | 2-pyrazin-2-yl-N-[(3-thiophen-2-yl-1H-1,2,4-triazol-5-yl)methyl]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 133293701 |
| Molecular Formula | C21H18N8S2 |
| Molecular Weight | 446.57 g/mol |
| Exact Mass | 446.11 |
| IUPAC Name | 2-pyrazin-2-yl-N-[(3-thiophen-2-yl-1H-1,2,4-triazol-5-yl)methyl]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-amine |
| SMILES | c1csc(-c2n[nH]c(CNc3nc(-c4cnccn4)nc4sc5c(c34)CCCC5)n2)c1 |
| InChI | InChI=1S/C21H18N8S2/c1-2-5-14-12(4-1)17-20(24-11-16-25-19(29-28-16)15-6-3-9-30-15)26-18(27-21(17)31-14)13-10-22-7-8-23-13/h3,6-10H,1-2,4-5,11H2,(H,24,26,27)(H,25,28,29) |
| InChIKey | DEXRQJKZWQVCNH-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 105.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.57 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |