C13H12N4S2 — CID 62250836
(10-thiophen-2-yl-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-yl)hydrazine (PubChem CID 62250836) has the molecular formula C13H12N4S2 and a molecular weight of 288.40 g/mol. Its IUPAC name is (10-thiophen-2-yl-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-yl)hydrazine.
| Compound Name | (10-thiophen-2-yl-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-yl)hydrazine |
|---|---|
| PubChem CID | 62250836 |
| Molecular Formula | C13H12N4S2 |
| Molecular Weight | 288.40 g/mol |
| Exact Mass | 288.05 |
| IUPAC Name | (10-thiophen-2-yl-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-yl)hydrazine |
| SMILES | NNc1nc(-c2cccs2)nc2sc3c(c12)CCC3 |
| InChI | InChI=1S/C13H12N4S2/c14-17-12-10-7-3-1-4-8(7)19-13(10)16-11(15-12)9-5-2-6-18-9/h2,5-6H,1,3-4,14H2,(H,15,16,17) |
| InChIKey | XMMHIJVAGXZNIG-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.40 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|