C17H18N4S2 — CID 3750738
(2-benzylsulfanyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl)hydrazine (PubChem CID 3750738) has the molecular formula C17H18N4S2 and a molecular weight of 342.49 g/mol. Its IUPAC name is (2-benzylsulfanyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl)hydrazine.
| Compound Name | (2-benzylsulfanyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl)hydrazine |
|---|---|
| PubChem CID | 3750738 |
| Molecular Formula | C17H18N4S2 |
| Molecular Weight | 342.49 g/mol |
| Exact Mass | 342.10 |
| IUPAC Name | (2-benzylsulfanyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl)hydrazine |
| SMILES | NNc1nc(SCc2ccccc2)nc2sc3c(c12)CCCC3 |
| InChI | InChI=1S/C17H18N4S2/c18-21-15-14-12-8-4-5-9-13(12)23-16(14)20-17(19-15)22-10-11-6-2-1-3-7-11/h1-3,6-7H,4-5,8-10,18H2,(H,19,20,21) |
| InChIKey | YTAFMEYPKYMFJJ-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.49 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|