C17H18N4O2S — CID 3197583
N-[2-(5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-ylamino)ethyl]furan-2-carboxamide (PubChem CID 3197583) has the molecular formula C17H18N4O2S and a molecular weight of 342.42 g/mol. Its IUPAC name is N-[2-(5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-ylamino)ethyl]furan-2-carboxamide.
| Compound Name | N-[2-(5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-ylamino)ethyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 3197583 |
| Molecular Formula | C17H18N4O2S |
| Molecular Weight | 342.42 g/mol |
| Exact Mass | 342.12 |
| IUPAC Name | N-[2-(5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-ylamino)ethyl]furan-2-carboxamide |
| SMILES | O=C(NCCNc1ncnc2sc3c(c12)CCCC3)c1ccco1 |
| InChI | InChI=1S/C17H18N4O2S/c22-16(12-5-3-9-23-12)19-8-7-18-15-14-11-4-1-2-6-13(11)24-17(14)21-10-20-15/h3,5,9-10H,1-2,4,6-8H2,(H,19,22)(H,18,20,21) |
| InChIKey | YARPIRYWSHUZIM-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 80.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.42 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|