C18H20N6O2S2 — CID 135618342
ethyl N-[3-methyl-4-[(E)-C-methyl-N-(7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-ylamino)carbonimidoyl]-1,2-thiazol-5-yl]carbamate (PubChem CID 135618342) has the molecular formula C18H20N6O2S2 and a molecular weight of 416.53 g/mol. Its IUPAC name is ethyl N-[3-methyl-4-[(E)-C-methyl-N-(7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-ylamino)carbonimidoyl]-1,2-thiazol-5-yl]carbamate.
| Compound Name | ethyl N-[3-methyl-4-[(E)-C-methyl-N-(7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-ylamino)carbonimidoyl]-1,2-thiazol-5-yl]carbamate |
|---|---|
| PubChem CID | 135618342 |
| Molecular Formula | C18H20N6O2S2 |
| Molecular Weight | 416.53 g/mol |
| Exact Mass | 416.11 |
| IUPAC Name | ethyl N-[3-methyl-4-[(E)-C-methyl-N-(7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-ylamino)carbonimidoyl]-1,2-thiazol-5-yl]carbamate |
| SMILES | CCOC(=O)Nc1snc(C)c1/C(C)=N/Nc1ncnc2sc3c(c12)CCC3 |
| InChI | InChI=1S/C18H20N6O2S2/c1-4-26-18(25)21-17-13(10(3)24-28-17)9(2)22-23-15-14-11-6-5-7-12(11)27-16(14)20-8-19-15/h8H,4-7H2,1-3H3,(H,21,25)(H,19,20,23)/b22-9+ |
| InChIKey | VEIMREOQGSJILV-LSFURLLWSA-N |
| XLogP | 4.35 |
| TPSA | 101.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.53 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|