C20H27FN5OS+ — CID 9030019
N-[(Z)-1-[4-(4-ethylpiperazin-4-ium-1-yl)-3-fluorophenyl]ethylideneamino]-2-(4-methyl-1,3-thiazol-2-yl)acetamide (PubChem CID 9030019) has the molecular formula C20H27FN5OS+ and a molecular weight of 404.54 g/mol. Its IUPAC name is N-[(Z)-1-[4-(4-ethylpiperazin-4-ium-1-yl)-3-fluorophenyl]ethylideneamino]-2-(4-methyl-1,3-thiazol-2-yl)acetamide.
| Compound Name | N-[(Z)-1-[4-(4-ethylpiperazin-4-ium-1-yl)-3-fluorophenyl]ethylideneamino]-2-(4-methyl-1,3-thiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 9030019 |
| Molecular Formula | C20H27FN5OS+ |
| Molecular Weight | 404.54 g/mol |
| Exact Mass | 404.19 |
| IUPAC Name | N-[(Z)-1-[4-(4-ethylpiperazin-4-ium-1-yl)-3-fluorophenyl]ethylideneamino]-2-(4-methyl-1,3-thiazol-2-yl)acetamide |
| SMILES | CC[NH+]1CCN(c2ccc(/C(C)=N\NC(=O)Cc3nc(C)cs3)cc2F)CC1 |
| InChI | InChI=1S/C20H26FN5OS/c1-4-25-7-9-26(10-8-25)18-6-5-16(11-17(18)21)15(3)23-24-19(27)12-20-22-14(2)13-28-20/h5-6,11,13H,4,7-10,12H2,1-3H3,(H,24,27)/p+1/b23-15- |
| InChIKey | XABXVPZCFSAEIP-HAHDFKILSA-O |
| XLogP | 1.40 |
| TPSA | 62.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.54 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|