C20H25FN5O+ — CID 9015567
N-[(Z)-1-[4-(4-ethylpiperazin-4-ium-1-yl)-3-fluorophenyl]ethylideneamino]pyridine-2-carboxamide (PubChem CID 9015567) has the molecular formula C20H25FN5O+ and a molecular weight of 370.45 g/mol. Its IUPAC name is N-[(Z)-1-[4-(4-ethylpiperazin-4-ium-1-yl)-3-fluorophenyl]ethylideneamino]pyridine-2-carboxamide.
| Compound Name | N-[(Z)-1-[4-(4-ethylpiperazin-4-ium-1-yl)-3-fluorophenyl]ethylideneamino]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 9015567 |
| Molecular Formula | C20H25FN5O+ |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.20 |
| IUPAC Name | N-[(Z)-1-[4-(4-ethylpiperazin-4-ium-1-yl)-3-fluorophenyl]ethylideneamino]pyridine-2-carboxamide |
| SMILES | CC[NH+]1CCN(c2ccc(/C(C)=N\NC(=O)c3ccccn3)cc2F)CC1 |
| InChI | InChI=1S/C20H24FN5O/c1-3-25-10-12-26(13-11-25)19-8-7-16(14-17(19)21)15(2)23-24-20(27)18-6-4-5-9-22-18/h4-9,14H,3,10-13H2,1-2H3,(H,24,27)/p+1/b23-15- |
| InChIKey | NPSMVCAEMOJYIC-HAHDFKILSA-O |
| XLogP | 1.10 |
| TPSA | 62.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|