C24H32FN4O2+ — CID 9256183
2-(2,5-dimethylphenoxy)-N-[(Z)-1-[4-(4-ethylpiperazin-4-ium-1-yl)-3-fluorophenyl]ethylideneamino]acetamide (PubChem CID 9256183) has the molecular formula C24H32FN4O2+ and a molecular weight of 427.54 g/mol. Its IUPAC name is 2-(2,5-dimethylphenoxy)-N-[(Z)-1-[4-(4-ethylpiperazin-4-ium-1-yl)-3-fluorophenyl]ethylideneamino]acetamide.
| Compound Name | 2-(2,5-dimethylphenoxy)-N-[(Z)-1-[4-(4-ethylpiperazin-4-ium-1-yl)-3-fluorophenyl]ethylideneamino]acetamide |
|---|---|
| PubChem CID | 9256183 |
| Molecular Formula | C24H32FN4O2+ |
| Molecular Weight | 427.54 g/mol |
| Exact Mass | 427.25 |
| IUPAC Name | 2-(2,5-dimethylphenoxy)-N-[(Z)-1-[4-(4-ethylpiperazin-4-ium-1-yl)-3-fluorophenyl]ethylideneamino]acetamide |
| SMILES | CC[NH+]1CCN(c2ccc(/C(C)=N\NC(=O)COc3cc(C)ccc3C)cc2F)CC1 |
| InChI | InChI=1S/C24H31FN4O2/c1-5-28-10-12-29(13-11-28)22-9-8-20(15-21(22)25)19(4)26-27-24(30)16-31-23-14-17(2)6-7-18(23)3/h6-9,14-15H,5,10-13,16H2,1-4H3,(H,27,30)/p+1/b26-19- |
| InChIKey | VGLJAGAGMIQCNP-XHPQRKPJSA-O |
| XLogP | 2.09 |
| TPSA | 58.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.54 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|