C23H27FN5O2+ — CID 9256841
2-(4-cyanophenoxy)-N-[(Z)-1-[4-(4-ethylpiperazin-4-ium-1-yl)-3-fluorophenyl]ethylideneamino]acetamide (PubChem CID 9256841) has the molecular formula C23H27FN5O2+ and a molecular weight of 424.50 g/mol. Its IUPAC name is 2-(4-cyanophenoxy)-N-[(Z)-1-[4-(4-ethylpiperazin-4-ium-1-yl)-3-fluorophenyl]ethylideneamino]acetamide.
| Compound Name | 2-(4-cyanophenoxy)-N-[(Z)-1-[4-(4-ethylpiperazin-4-ium-1-yl)-3-fluorophenyl]ethylideneamino]acetamide |
|---|---|
| PubChem CID | 9256841 |
| Molecular Formula | C23H27FN5O2+ |
| Molecular Weight | 424.50 g/mol |
| Exact Mass | 424.21 |
| IUPAC Name | 2-(4-cyanophenoxy)-N-[(Z)-1-[4-(4-ethylpiperazin-4-ium-1-yl)-3-fluorophenyl]ethylideneamino]acetamide |
| SMILES | CC[NH+]1CCN(c2ccc(/C(C)=N\NC(=O)COc3ccc(C#N)cc3)cc2F)CC1 |
| InChI | InChI=1S/C23H26FN5O2/c1-3-28-10-12-29(13-11-28)22-9-6-19(14-21(22)24)17(2)26-27-23(30)16-31-20-7-4-18(15-25)5-8-20/h4-9,14H,3,10-13,16H2,1-2H3,(H,27,30)/p+1/b26-17- |
| InChIKey | JAIGHFCMPZRJFT-ONUIUJJFSA-O |
| XLogP | 1.34 |
| TPSA | 82.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.50 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|