C23H29FN5O2+ — CID 9179951
N'-[(Z)-1-[4-(4-ethylpiperazin-4-ium-1-yl)-3-fluorophenyl]ethylideneamino]-N-(4-methylphenyl)oxamide (PubChem CID 9179951) has the molecular formula C23H29FN5O2+ and a molecular weight of 426.52 g/mol. Its IUPAC name is N'-[(Z)-1-[4-(4-ethylpiperazin-4-ium-1-yl)-3-fluorophenyl]ethylideneamino]-N-(4-methylphenyl)oxamide.
| Compound Name | N'-[(Z)-1-[4-(4-ethylpiperazin-4-ium-1-yl)-3-fluorophenyl]ethylideneamino]-N-(4-methylphenyl)oxamide |
|---|---|
| PubChem CID | 9179951 |
| Molecular Formula | C23H29FN5O2+ |
| Molecular Weight | 426.52 g/mol |
| Exact Mass | 426.23 |
| IUPAC Name | N'-[(Z)-1-[4-(4-ethylpiperazin-4-ium-1-yl)-3-fluorophenyl]ethylideneamino]-N-(4-methylphenyl)oxamide |
| SMILES | CC[NH+]1CCN(c2ccc(/C(C)=N\NC(=O)C(=O)Nc3ccc(C)cc3)cc2F)CC1 |
| InChI | InChI=1S/C23H28FN5O2/c1-4-28-11-13-29(14-12-28)21-10-7-18(15-20(21)24)17(3)26-27-23(31)22(30)25-19-8-5-16(2)6-9-19/h5-10,15H,4,11-14H2,1-3H3,(H,25,30)(H,27,31)/p+1/b26-17- |
| InChIKey | BGDDSHRBVMGMBQ-ONUIUJJFSA-O |
| XLogP | 1.34 |
| TPSA | 78.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.52 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|