C17H19FN4O2 — CID 9026928
N-[(Z)-1-(3-fluoro-4-morpholin-4-ylphenyl)ethylideneamino]-1H-pyrrole-2-carboxamide (PubChem CID 9026928) has the molecular formula C17H19FN4O2 and a molecular weight of 330.36 g/mol. Its IUPAC name is N-[(Z)-1-(3-fluoro-4-morpholin-4-ylphenyl)ethylideneamino]-1H-pyrrole-2-carboxamide.
| Compound Name | N-[(Z)-1-(3-fluoro-4-morpholin-4-ylphenyl)ethylideneamino]-1H-pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 9026928 |
| Molecular Formula | C17H19FN4O2 |
| Molecular Weight | 330.36 g/mol |
| Exact Mass | 330.15 |
| IUPAC Name | N-[(Z)-1-(3-fluoro-4-morpholin-4-ylphenyl)ethylideneamino]-1H-pyrrole-2-carboxamide |
| SMILES | C/C(=N/NC(=O)c1ccc[nH]1)c1ccc(N2CCOCC2)c(F)c1 |
| InChI | InChI=1S/C17H19FN4O2/c1-12(20-21-17(23)15-3-2-6-19-15)13-4-5-16(14(18)11-13)22-7-9-24-10-8-22/h2-6,11,19H,7-10H2,1H3,(H,21,23)/b20-12- |
| InChIKey | JJZPNYNRRQJEFC-NDENLUEZSA-N |
| XLogP | 2.14 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.36 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|