C15H22NO3+ — CID 2450170
1-[4-ethoxy-3-(morpholin-4-ium-4-ylmethyl)phenyl]ethanone (PubChem CID 2450170) has the molecular formula C15H22NO3+ and a molecular weight of 264.34 g/mol. Its IUPAC name is 1-[4-ethoxy-3-(morpholin-4-ium-4-ylmethyl)phenyl]ethanone.
| Compound Name | 1-[4-ethoxy-3-(morpholin-4-ium-4-ylmethyl)phenyl]ethanone |
|---|---|
| PubChem CID | 2450170 |
| Molecular Formula | C15H22NO3+ |
| Molecular Weight | 264.34 g/mol |
| Exact Mass | 264.16 |
| IUPAC Name | 1-[4-ethoxy-3-(morpholin-4-ium-4-ylmethyl)phenyl]ethanone |
| SMILES | CCOc1ccc(C(C)=O)cc1C[NH+]1CCOCC1 |
| InChI | InChI=1S/C15H21NO3/c1-3-19-15-5-4-13(12(2)17)10-14(15)11-16-6-8-18-9-7-16/h4-5,10H,3,6-9,11H2,1-2H3/p+1 |
| InChIKey | ZAHAYRAAFOGQNB-UHFFFAOYSA-O |
| XLogP | 0.70 |
| TPSA | 39.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.34 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |