C22H25N4O3+ — CID 9149237
3-methyl-N-[(1S)-2-morpholin-4-ium-4-yl-1-phenylethyl]-4-oxophthalazine-1-carboxamide (PubChem CID 9149237) has the molecular formula C22H25N4O3+ and a molecular weight of 393.47 g/mol. Its IUPAC name is 3-methyl-N-[(1S)-2-morpholin-4-ium-4-yl-1-phenylethyl]-4-oxophthalazine-1-carboxamide.
| Compound Name | 3-methyl-N-[(1S)-2-morpholin-4-ium-4-yl-1-phenylethyl]-4-oxophthalazine-1-carboxamide |
|---|---|
| PubChem CID | 9149237 |
| Molecular Formula | C22H25N4O3+ |
| Molecular Weight | 393.47 g/mol |
| Exact Mass | 393.19 |
| IUPAC Name | 3-methyl-N-[(1S)-2-morpholin-4-ium-4-yl-1-phenylethyl]-4-oxophthalazine-1-carboxamide |
| SMILES | Cn1nc(C(=O)N[C@H](C[NH+]2CCOCC2)c2ccccc2)c2ccccc2c1=O |
| InChI | InChI=1S/C22H24N4O3/c1-25-22(28)18-10-6-5-9-17(18)20(24-25)21(27)23-19(16-7-3-2-4-8-16)15-26-11-13-29-14-12-26/h2-10,19H,11-15H2,1H3,(H,23,27)/p+1/t19-/m1/s1 |
| InChIKey | ANJOVOSVMOQGBI-LJQANCHMSA-O |
| XLogP | 0.32 |
| TPSA | 77.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.47 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |