C23H27N4O3+ — CID 9149901
2-(3-methyl-4-oxophthalazin-1-yl)-N-[(1R)-2-morpholin-4-ium-4-yl-1-phenylethyl]acetamide (PubChem CID 9149901) has the molecular formula C23H27N4O3+ and a molecular weight of 407.49 g/mol. Its IUPAC name is 2-(3-methyl-4-oxophthalazin-1-yl)-N-[(1R)-2-morpholin-4-ium-4-yl-1-phenylethyl]acetamide.
| Compound Name | 2-(3-methyl-4-oxophthalazin-1-yl)-N-[(1R)-2-morpholin-4-ium-4-yl-1-phenylethyl]acetamide |
|---|---|
| PubChem CID | 9149901 |
| Molecular Formula | C23H27N4O3+ |
| Molecular Weight | 407.49 g/mol |
| Exact Mass | 407.21 |
| IUPAC Name | 2-(3-methyl-4-oxophthalazin-1-yl)-N-[(1R)-2-morpholin-4-ium-4-yl-1-phenylethyl]acetamide |
| SMILES | Cn1nc(CC(=O)N[C@@H](C[NH+]2CCOCC2)c2ccccc2)c2ccccc2c1=O |
| InChI | InChI=1S/C23H26N4O3/c1-26-23(29)19-10-6-5-9-18(19)20(25-26)15-22(28)24-21(17-7-3-2-4-8-17)16-27-11-13-30-14-12-27/h2-10,21H,11-16H2,1H3,(H,24,28)/p+1/t21-/m0/s1 |
| InChIKey | ONSBGBGTCIKAIG-NRFANRHFSA-O |
| XLogP | 0.25 |
| TPSA | 77.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.49 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |