C24H27N3O4 — CID 55375792
[2-[(3-methyl-1-phenylbutyl)amino]-2-oxoethyl] 2-(3-methyl-4-oxophthalazin-1-yl)acetate (PubChem CID 55375792) has the molecular formula C24H27N3O4 and a molecular weight of 421.50 g/mol. Its IUPAC name is [2-[(3-methyl-1-phenylbutyl)amino]-2-oxoethyl] 2-(3-methyl-4-oxophthalazin-1-yl)acetate.
| Compound Name | [2-[(3-methyl-1-phenylbutyl)amino]-2-oxoethyl] 2-(3-methyl-4-oxophthalazin-1-yl)acetate |
|---|---|
| PubChem CID | 55375792 |
| Molecular Formula | C24H27N3O4 |
| Molecular Weight | 421.50 g/mol |
| Exact Mass | 421.20 |
| IUPAC Name | [2-[(3-methyl-1-phenylbutyl)amino]-2-oxoethyl] 2-(3-methyl-4-oxophthalazin-1-yl)acetate |
| SMILES | CC(C)CC(NC(=O)COC(=O)Cc1nn(C)c(=O)c2ccccc12)c1ccccc1 |
| InChI | InChI=1S/C24H27N3O4/c1-16(2)13-20(17-9-5-4-6-10-17)25-22(28)15-31-23(29)14-21-18-11-7-8-12-19(18)24(30)27(3)26-21/h4-12,16,20H,13-15H2,1-3H3,(H,25,28) |
| InChIKey | ICZCCAXTQJVOGM-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 90.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.50 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |