C14H21NO2 — CID 94870263
2-methoxy-N-[(1S)-3-methyl-1-phenylbutyl]acetamide (PubChem CID 94870263) has the molecular formula C14H21NO2 and a molecular weight of 235.33 g/mol. Its IUPAC name is 2-methoxy-N-[(1S)-3-methyl-1-phenylbutyl]acetamide.
| Compound Name | 2-methoxy-N-[(1S)-3-methyl-1-phenylbutyl]acetamide |
|---|---|
| PubChem CID | 94870263 |
| Molecular Formula | C14H21NO2 |
| Molecular Weight | 235.33 g/mol |
| Exact Mass | 235.16 |
| IUPAC Name | 2-methoxy-N-[(1S)-3-methyl-1-phenylbutyl]acetamide |
| SMILES | COCC(=O)N[C@@H](CC(C)C)c1ccccc1 |
| InChI | InChI=1S/C14H21NO2/c1-11(2)9-13(15-14(16)10-17-3)12-7-5-4-6-8-12/h4-8,11,13H,9-10H2,1-3H3,(H,15,16)/t13-/m0/s1 |
| InChIKey | BBRXKTRBEUVACE-ZDUSSCGKSA-N |
| XLogP | 2.54 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.33 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |