C22H27NO4 — CID 8510915
[2-[[(1R)-3-methyl-1-phenylbutyl]amino]-2-oxoethyl] 2-(4-methoxyphenyl)acetate (PubChem CID 8510915) has the molecular formula C22H27NO4 and a molecular weight of 369.46 g/mol. Its IUPAC name is [2-[[(1R)-3-methyl-1-phenylbutyl]amino]-2-oxoethyl] 2-(4-methoxyphenyl)acetate.
| Compound Name | [2-[[(1R)-3-methyl-1-phenylbutyl]amino]-2-oxoethyl] 2-(4-methoxyphenyl)acetate |
|---|---|
| PubChem CID | 8510915 |
| Molecular Formula | C22H27NO4 |
| Molecular Weight | 369.46 g/mol |
| Exact Mass | 369.19 |
| IUPAC Name | [2-[[(1R)-3-methyl-1-phenylbutyl]amino]-2-oxoethyl] 2-(4-methoxyphenyl)acetate |
| SMILES | COc1ccc(CC(=O)OCC(=O)N[C@H](CC(C)C)c2ccccc2)cc1 |
| InChI | InChI=1S/C22H27NO4/c1-16(2)13-20(18-7-5-4-6-8-18)23-21(24)15-27-22(25)14-17-9-11-19(26-3)12-10-17/h4-12,16,20H,13-15H2,1-3H3,(H,23,24)/t20-/m1/s1 |
| InChIKey | XZAKZAZUYWRRTH-HXUWFJFHSA-N |
| XLogP | 3.68 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.46 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |