C18H23N3O4 — CID 8958909
[(2R)-1-(2-methylpropylamino)-1-oxopropan-2-yl] 2-(3-methyl-4-oxophthalazin-1-yl)acetate (PubChem CID 8958909) has the molecular formula C18H23N3O4 and a molecular weight of 345.40 g/mol. Its IUPAC name is [(2R)-1-(2-methylpropylamino)-1-oxopropan-2-yl] 2-(3-methyl-4-oxophthalazin-1-yl)acetate.
| Compound Name | [(2R)-1-(2-methylpropylamino)-1-oxopropan-2-yl] 2-(3-methyl-4-oxophthalazin-1-yl)acetate |
|---|---|
| PubChem CID | 8958909 |
| Molecular Formula | C18H23N3O4 |
| Molecular Weight | 345.40 g/mol |
| Exact Mass | 345.17 |
| IUPAC Name | [(2R)-1-(2-methylpropylamino)-1-oxopropan-2-yl] 2-(3-methyl-4-oxophthalazin-1-yl)acetate |
| SMILES | CC(C)CNC(=O)[C@@H](C)OC(=O)Cc1nn(C)c(=O)c2ccccc12 |
| InChI | InChI=1S/C18H23N3O4/c1-11(2)10-19-17(23)12(3)25-16(22)9-15-13-7-5-6-8-14(13)18(24)21(4)20-15/h5-8,11-12H,9-10H2,1-4H3,(H,19,23)/t12-/m1/s1 |
| InChIKey | HBEHDEBNRYNLLI-GFCCVEGCSA-N |
| XLogP | 1.18 |
| TPSA | 90.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.40 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |