C28H27N3O4 — CID 55375576
[1-(dibenzylamino)-1-oxopropan-2-yl] 2-(3-methyl-4-oxophthalazin-1-yl)acetate (PubChem CID 55375576) has the molecular formula C28H27N3O4 and a molecular weight of 469.54 g/mol. Its IUPAC name is [1-(dibenzylamino)-1-oxopropan-2-yl] 2-(3-methyl-4-oxophthalazin-1-yl)acetate.
| Compound Name | [1-(dibenzylamino)-1-oxopropan-2-yl] 2-(3-methyl-4-oxophthalazin-1-yl)acetate |
|---|---|
| PubChem CID | 55375576 |
| Molecular Formula | C28H27N3O4 |
| Molecular Weight | 469.54 g/mol |
| Exact Mass | 469.20 |
| IUPAC Name | [1-(dibenzylamino)-1-oxopropan-2-yl] 2-(3-methyl-4-oxophthalazin-1-yl)acetate |
| SMILES | CC(OC(=O)Cc1nn(C)c(=O)c2ccccc12)C(=O)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C28H27N3O4/c1-20(35-26(32)17-25-23-15-9-10-16-24(23)28(34)30(2)29-25)27(33)31(18-21-11-5-3-6-12-21)19-22-13-7-4-8-14-22/h3-16,20H,17-19H2,1-2H3 |
| InChIKey | ZNYZZUJFULCXJP-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 81.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.54 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |