C20H20N4O6S — CID 43030034
[1-oxo-1-(4-sulfamoylanilino)propan-2-yl] 2-(3-methyl-4-oxophthalazin-1-yl)acetate (PubChem CID 43030034) has the molecular formula C20H20N4O6S and a molecular weight of 444.47 g/mol. Its IUPAC name is [1-oxo-1-(4-sulfamoylanilino)propan-2-yl] 2-(3-methyl-4-oxophthalazin-1-yl)acetate.
| Compound Name | [1-oxo-1-(4-sulfamoylanilino)propan-2-yl] 2-(3-methyl-4-oxophthalazin-1-yl)acetate |
|---|---|
| PubChem CID | 43030034 |
| Molecular Formula | C20H20N4O6S |
| Molecular Weight | 444.47 g/mol |
| Exact Mass | 444.11 |
| IUPAC Name | [1-oxo-1-(4-sulfamoylanilino)propan-2-yl] 2-(3-methyl-4-oxophthalazin-1-yl)acetate |
| SMILES | CC(OC(=O)Cc1nn(C)c(=O)c2ccccc12)C(=O)Nc1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C20H20N4O6S/c1-12(19(26)22-13-7-9-14(10-8-13)31(21,28)29)30-18(25)11-17-15-5-3-4-6-16(15)20(27)24(2)23-17/h3-10,12H,11H2,1-2H3,(H,22,26)(H2,21,28,29) |
| InChIKey | SSCUXMYWXVSNKA-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 150.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.47 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |