C21H20N4O5 — CID 55481547
[1-oxo-1-(phenylcarbamoylamino)propan-2-yl] 2-(3-methyl-4-oxophthalazin-1-yl)acetate (PubChem CID 55481547) has the molecular formula C21H20N4O5 and a molecular weight of 408.41 g/mol. Its IUPAC name is [1-oxo-1-(phenylcarbamoylamino)propan-2-yl] 2-(3-methyl-4-oxophthalazin-1-yl)acetate.
| Compound Name | [1-oxo-1-(phenylcarbamoylamino)propan-2-yl] 2-(3-methyl-4-oxophthalazin-1-yl)acetate |
|---|---|
| PubChem CID | 55481547 |
| Molecular Formula | C21H20N4O5 |
| Molecular Weight | 408.41 g/mol |
| Exact Mass | 408.14 |
| IUPAC Name | [1-oxo-1-(phenylcarbamoylamino)propan-2-yl] 2-(3-methyl-4-oxophthalazin-1-yl)acetate |
| SMILES | CC(OC(=O)Cc1nn(C)c(=O)c2ccccc12)C(=O)NC(=O)Nc1ccccc1 |
| InChI | InChI=1S/C21H20N4O5/c1-13(19(27)23-21(29)22-14-8-4-3-5-9-14)30-18(26)12-17-15-10-6-7-11-16(15)20(28)25(2)24-17/h3-11,13H,12H2,1-2H3,(H2,22,23,27,29) |
| InChIKey | NLDZXSFSOJNCIK-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 119.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.41 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |