C27H19N3O6 — CID 30366631
[2-[(9,10-dioxoanthracen-1-yl)amino]-2-oxoethyl] 2-(3-methyl-4-oxophthalazin-1-yl)acetate (PubChem CID 30366631) has the molecular formula C27H19N3O6 and a molecular weight of 481.46 g/mol. Its IUPAC name is [2-[(9,10-dioxoanthracen-1-yl)amino]-2-oxoethyl] 2-(3-methyl-4-oxophthalazin-1-yl)acetate.
| Compound Name | [2-[(9,10-dioxoanthracen-1-yl)amino]-2-oxoethyl] 2-(3-methyl-4-oxophthalazin-1-yl)acetate |
|---|---|
| PubChem CID | 30366631 |
| Molecular Formula | C27H19N3O6 |
| Molecular Weight | 481.46 g/mol |
| Exact Mass | 481.13 |
| IUPAC Name | [2-[(9,10-dioxoanthracen-1-yl)amino]-2-oxoethyl] 2-(3-methyl-4-oxophthalazin-1-yl)acetate |
| SMILES | Cn1nc(CC(=O)OCC(=O)Nc2cccc3c2C(=O)c2ccccc2C3=O)c2ccccc2c1=O |
| InChI | InChI=1S/C27H19N3O6/c1-30-27(35)18-10-5-2-7-15(18)21(29-30)13-23(32)36-14-22(31)28-20-12-6-11-19-24(20)26(34)17-9-4-3-8-16(17)25(19)33/h2-12H,13-14H2,1H3,(H,28,31) |
| InChIKey | NOKOZJWTHOABOL-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 124.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.46 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|