C23H26N3O4+ — CID 9150265
2-(1,3-dioxo-4H-isoquinolin-2-yl)-N-[(1R)-2-morpholin-4-ium-4-yl-1-phenylethyl]acetamide (PubChem CID 9150265) has the molecular formula C23H26N3O4+ and a molecular weight of 408.48 g/mol. Its IUPAC name is 2-(1,3-dioxo-4H-isoquinolin-2-yl)-N-[(1R)-2-morpholin-4-ium-4-yl-1-phenylethyl]acetamide.
| Compound Name | 2-(1,3-dioxo-4H-isoquinolin-2-yl)-N-[(1R)-2-morpholin-4-ium-4-yl-1-phenylethyl]acetamide |
|---|---|
| PubChem CID | 9150265 |
| Molecular Formula | C23H26N3O4+ |
| Molecular Weight | 408.48 g/mol |
| Exact Mass | 408.19 |
| IUPAC Name | 2-(1,3-dioxo-4H-isoquinolin-2-yl)-N-[(1R)-2-morpholin-4-ium-4-yl-1-phenylethyl]acetamide |
| SMILES | O=C(CN1C(=O)Cc2ccccc2C1=O)N[C@@H](C[NH+]1CCOCC1)c1ccccc1 |
| InChI | InChI=1S/C23H25N3O4/c27-21(16-26-22(28)14-18-8-4-5-9-19(18)23(26)29)24-20(17-6-2-1-3-7-17)15-25-10-12-30-13-11-25/h1-9,20H,10-16H2,(H,24,27)/p+1/t20-/m0/s1 |
| InChIKey | WHRQTLXOFVKNOD-FQEVSTJZSA-O |
| XLogP | -0.02 |
| TPSA | 80.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.48 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|