C21H24N3O3+ — CID 8938188
[(2S)-2-[[2-(1,3-dioxo-4H-isoquinolin-2-yl)acetyl]amino]-2-phenylethyl]-dimethylazanium (PubChem CID 8938188) has the molecular formula C21H24N3O3+ and a molecular weight of 366.44 g/mol. Its IUPAC name is [(2S)-2-[[2-(1,3-dioxo-4H-isoquinolin-2-yl)acetyl]amino]-2-phenylethyl]-dimethylazanium.
| Compound Name | [(2S)-2-[[2-(1,3-dioxo-4H-isoquinolin-2-yl)acetyl]amino]-2-phenylethyl]-dimethylazanium |
|---|---|
| PubChem CID | 8938188 |
| Molecular Formula | C21H24N3O3+ |
| Molecular Weight | 366.44 g/mol |
| Exact Mass | 366.18 |
| IUPAC Name | [(2S)-2-[[2-(1,3-dioxo-4H-isoquinolin-2-yl)acetyl]amino]-2-phenylethyl]-dimethylazanium |
| SMILES | C[NH+](C)C[C@@H](NC(=O)CN1C(=O)Cc2ccccc2C1=O)c1ccccc1 |
| InChI | InChI=1S/C21H23N3O3/c1-23(2)13-18(15-8-4-3-5-9-15)22-19(25)14-24-20(26)12-16-10-6-7-11-17(16)21(24)27/h3-11,18H,12-14H2,1-2H3,(H,22,25)/p+1/t18-/m1/s1 |
| InChIKey | QWNFPPTUTQZGLC-GOSISDBHSA-O |
| XLogP | 0.21 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.44 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|