C19H15Cl2FN2O3 — CID 9187295
N-[(1S)-1-(2,4-dichloro-5-fluorophenyl)ethyl]-2-(1,3-dioxo-4H-isoquinolin-2-yl)acetamide (PubChem CID 9187295) has the molecular formula C19H15Cl2FN2O3 and a molecular weight of 409.24 g/mol. Its IUPAC name is N-[(1S)-1-(2,4-dichloro-5-fluorophenyl)ethyl]-2-(1,3-dioxo-4H-isoquinolin-2-yl)acetamide.
| Compound Name | N-[(1S)-1-(2,4-dichloro-5-fluorophenyl)ethyl]-2-(1,3-dioxo-4H-isoquinolin-2-yl)acetamide |
|---|---|
| PubChem CID | 9187295 |
| Molecular Formula | C19H15Cl2FN2O3 |
| Molecular Weight | 409.24 g/mol |
| Exact Mass | 408.04 |
| IUPAC Name | N-[(1S)-1-(2,4-dichloro-5-fluorophenyl)ethyl]-2-(1,3-dioxo-4H-isoquinolin-2-yl)acetamide |
| SMILES | C[C@H](NC(=O)CN1C(=O)Cc2ccccc2C1=O)c1cc(F)c(Cl)cc1Cl |
| InChI | InChI=1S/C19H15Cl2FN2O3/c1-10(13-7-16(22)15(21)8-14(13)20)23-17(25)9-24-18(26)6-11-4-2-3-5-12(11)19(24)27/h2-5,7-8,10H,6,9H2,1H3,(H,23,25)/t10-/m0/s1 |
| InChIKey | SHTGSTIJKRDHBJ-JTQLQIEISA-N |
| XLogP | 3.53 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.24 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|