C24H21N3O3 — CID 9206637
N'-benzyl-2-(1,3-dioxo-4H-isoquinolin-2-yl)-N'-phenylacetohydrazide (PubChem CID 9206637) has the molecular formula C24H21N3O3 and a molecular weight of 399.45 g/mol. Its IUPAC name is N'-benzyl-2-(1,3-dioxo-4H-isoquinolin-2-yl)-N'-phenylacetohydrazide.
| Compound Name | N'-benzyl-2-(1,3-dioxo-4H-isoquinolin-2-yl)-N'-phenylacetohydrazide |
|---|---|
| PubChem CID | 9206637 |
| Molecular Formula | C24H21N3O3 |
| Molecular Weight | 399.45 g/mol |
| Exact Mass | 399.16 |
| IUPAC Name | N'-benzyl-2-(1,3-dioxo-4H-isoquinolin-2-yl)-N'-phenylacetohydrazide |
| SMILES | O=C(CN1C(=O)Cc2ccccc2C1=O)NN(Cc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H21N3O3/c28-22(17-26-23(29)15-19-11-7-8-14-21(19)24(26)30)25-27(20-12-5-2-6-13-20)16-18-9-3-1-4-10-18/h1-14H,15-17H2,(H,25,28) |
| InChIKey | FMVJNJYCRAMUAO-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.45 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|