C22H23FN4O3 — CID 4807578
N-[2-(4-fluorophenyl)-2-morpholin-4-ylethyl]-3-methyl-4-oxophthalazine-1-carboxamide (PubChem CID 4807578) has the molecular formula C22H23FN4O3 and a molecular weight of 410.45 g/mol. Its IUPAC name is N-[2-(4-fluorophenyl)-2-morpholin-4-ylethyl]-3-methyl-4-oxophthalazine-1-carboxamide.
| Compound Name | N-[2-(4-fluorophenyl)-2-morpholin-4-ylethyl]-3-methyl-4-oxophthalazine-1-carboxamide |
|---|---|
| PubChem CID | 4807578 |
| Molecular Formula | C22H23FN4O3 |
| Molecular Weight | 410.45 g/mol |
| Exact Mass | 410.18 |
| IUPAC Name | N-[2-(4-fluorophenyl)-2-morpholin-4-ylethyl]-3-methyl-4-oxophthalazine-1-carboxamide |
| SMILES | Cn1nc(C(=O)NCC(c2ccc(F)cc2)N2CCOCC2)c2ccccc2c1=O |
| InChI | InChI=1S/C22H23FN4O3/c1-26-22(29)18-5-3-2-4-17(18)20(25-26)21(28)24-14-19(27-10-12-30-13-11-27)15-6-8-16(23)9-7-15/h2-9,19H,10-14H2,1H3,(H,24,28) |
| InChIKey | QAASTHONNITETA-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 76.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.45 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |