C28H27FN4O3 — CID 31085409
3-benzyl-N-[(2R)-2-(4-fluorophenyl)-2-morpholin-4-ylethyl]-4-oxophthalazine-1-carboxamide (PubChem CID 31085409) has the molecular formula C28H27FN4O3 and a molecular weight of 486.55 g/mol. Its IUPAC name is 3-benzyl-N-[(2R)-2-(4-fluorophenyl)-2-morpholin-4-ylethyl]-4-oxophthalazine-1-carboxamide.
| Compound Name | 3-benzyl-N-[(2R)-2-(4-fluorophenyl)-2-morpholin-4-ylethyl]-4-oxophthalazine-1-carboxamide |
|---|---|
| PubChem CID | 31085409 |
| Molecular Formula | C28H27FN4O3 |
| Molecular Weight | 486.55 g/mol |
| Exact Mass | 486.21 |
| IUPAC Name | 3-benzyl-N-[(2R)-2-(4-fluorophenyl)-2-morpholin-4-ylethyl]-4-oxophthalazine-1-carboxamide |
| SMILES | O=C(NC[C@@H](c1ccc(F)cc1)N1CCOCC1)c1nn(Cc2ccccc2)c(=O)c2ccccc12 |
| InChI | InChI=1S/C28H27FN4O3/c29-22-12-10-21(11-13-22)25(32-14-16-36-17-15-32)18-30-27(34)26-23-8-4-5-9-24(23)28(35)33(31-26)19-20-6-2-1-3-7-20/h1-13,25H,14-19H2,(H,30,34)/t25-/m0/s1 |
| InChIKey | XLHWDKAGAAAKAM-VWLOTQADSA-N |
| XLogP | 3.39 |
| TPSA | 76.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.55 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |