C20H25N2O3+ — CID 9148385
4-methoxy-N-[(1R)-2-morpholin-4-ium-4-yl-1-phenylethyl]benzamide (PubChem CID 9148385) has the molecular formula C20H25N2O3+ and a molecular weight of 341.43 g/mol. Its IUPAC name is 4-methoxy-N-[(1R)-2-morpholin-4-ium-4-yl-1-phenylethyl]benzamide.
| Compound Name | 4-methoxy-N-[(1R)-2-morpholin-4-ium-4-yl-1-phenylethyl]benzamide |
|---|---|
| PubChem CID | 9148385 |
| Molecular Formula | C20H25N2O3+ |
| Molecular Weight | 341.43 g/mol |
| Exact Mass | 341.19 |
| IUPAC Name | 4-methoxy-N-[(1R)-2-morpholin-4-ium-4-yl-1-phenylethyl]benzamide |
| SMILES | COc1ccc(C(=O)N[C@@H](C[NH+]2CCOCC2)c2ccccc2)cc1 |
| InChI | InChI=1S/C20H24N2O3/c1-24-18-9-7-17(8-10-18)20(23)21-19(16-5-3-2-4-6-16)15-22-11-13-25-14-12-22/h2-10,19H,11-15H2,1H3,(H,21,23)/p+1/t19-/m0/s1 |
| InChIKey | RSASPPOVAIKUHK-IBGZPJMESA-O |
| XLogP | 1.08 |
| TPSA | 52.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.43 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |