C18H17NO2 — CID 97063453
4-methoxy-N-[(1S)-1-phenylbut-3-ynyl]benzamide (PubChem CID 97063453) has the molecular formula C18H17NO2 and a molecular weight of 279.34 g/mol. Its IUPAC name is 4-methoxy-N-[(1S)-1-phenylbut-3-ynyl]benzamide.
| Compound Name | 4-methoxy-N-[(1S)-1-phenylbut-3-ynyl]benzamide |
|---|---|
| PubChem CID | 97063453 |
| Molecular Formula | C18H17NO2 |
| Molecular Weight | 279.34 g/mol |
| Exact Mass | 279.13 |
| IUPAC Name | 4-methoxy-N-[(1S)-1-phenylbut-3-ynyl]benzamide |
| SMILES | C#CC[C@H](NC(=O)c1ccc(OC)cc1)c1ccccc1 |
| InChI | InChI=1S/C18H17NO2/c1-3-7-17(14-8-5-4-6-9-14)19-18(20)15-10-12-16(21-2)13-11-15/h1,4-6,8-13,17H,7H2,2H3,(H,19,20)/t17-/m0/s1 |
| InChIKey | JWRSSCCDEOWJAO-KRWDZBQOSA-N |
| XLogP | 3.19 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.34 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|