C12H16ClN5O2 — CID 85039912
1-[[5-chloro-3-methyl-1-(2-methylpropyl)pyrazol-4-yl]methylideneamino]imidazolidine-2,4-dione (PubChem CID 85039912) has the molecular formula C12H16ClN5O2 and a molecular weight of 297.75 g/mol. Its IUPAC name is 1-[[5-chloro-3-methyl-1-(2-methylpropyl)pyrazol-4-yl]methylideneamino]imidazolidine-2,4-dione.
| Compound Name | 1-[[5-chloro-3-methyl-1-(2-methylpropyl)pyrazol-4-yl]methylideneamino]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 85039912 |
| Molecular Formula | C12H16ClN5O2 |
| Molecular Weight | 297.75 g/mol |
| Exact Mass | 297.10 |
| IUPAC Name | 1-[[5-chloro-3-methyl-1-(2-methylpropyl)pyrazol-4-yl]methylideneamino]imidazolidine-2,4-dione |
| SMILES | Cc1nn(CC(C)C)c(Cl)c1C=NN1CC(=O)NC1=O |
| InChI | InChI=1S/C12H16ClN5O2/c1-7(2)5-17-11(13)9(8(3)16-17)4-14-18-6-10(19)15-12(18)20/h4,7H,5-6H2,1-3H3,(H,15,19,20) |
| InChIKey | LYXHYESNNKOBAW-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 79.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.75 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|