C14H11ClFN5O2 — CID 45115386
1-[[5-chloro-1-(4-fluorophenyl)-3-methylpyrazol-4-yl]methylideneamino]imidazolidine-2,4-dione (PubChem CID 45115386) has the molecular formula C14H11ClFN5O2 and a molecular weight of 335.73 g/mol. Its IUPAC name is 1-[[5-chloro-1-(4-fluorophenyl)-3-methylpyrazol-4-yl]methylideneamino]imidazolidine-2,4-dione.
| Compound Name | 1-[[5-chloro-1-(4-fluorophenyl)-3-methylpyrazol-4-yl]methylideneamino]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 45115386 |
| Molecular Formula | C14H11ClFN5O2 |
| Molecular Weight | 335.73 g/mol |
| Exact Mass | 335.06 |
| IUPAC Name | 1-[[5-chloro-1-(4-fluorophenyl)-3-methylpyrazol-4-yl]methylideneamino]imidazolidine-2,4-dione |
| SMILES | Cc1nn(-c2ccc(F)cc2)c(Cl)c1C=NN1CC(=O)NC1=O |
| InChI | InChI=1S/C14H11ClFN5O2/c1-8-11(6-17-20-7-12(22)18-14(20)23)13(15)21(19-8)10-4-2-9(16)3-5-10/h2-6H,7H2,1H3,(H,18,22,23) |
| InChIKey | JBHFITNXHWQGHN-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 79.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.73 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|